C12H16FN — CID 115633143
N-[(3-fluorophenyl)methyl]pent-4-en-2-amine (PubChem CID 115633143) has the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]pent-4-en-2-amine.
| Compound Name | N-[(3-fluorophenyl)methyl]pent-4-en-2-amine |
|---|---|
| PubChem CID | 115633143 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]pent-4-en-2-amine |
| SMILES | C=CCC(C)NCc1cccc(F)c1 |
| InChI | InChI=1S/C12H16FN/c1-3-5-10(2)14-9-11-6-4-7-12(13)8-11/h3-4,6-8,10,14H,1,5,9H2,2H3 |
| InChIKey | UMHGJAPNEMZEFV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|