About N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide
N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 115633394) has the molecular formula C12H11F3N4O2
and a molecular weight of 300.24 g/mol. Its IUPAC name is N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| PubChem CID | 115633394 |
| Molecular Formula | C12H11F3N4O2 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | Cc1[nH]nc(NC(=O)c2ccc(C(F)(F)F)[nH]c2=O)c1C |
| InChI | InChI=1S/C12H11F3N4O2/c1-5-6(2)18-19-9(5)17-11(21)7-3-4-8(12(13,14)15)16-10(7)20/h3-4H,1-2H3,(H,16,20)(H2,17,18,19,21) |
| InChIKey | MXCPEROVXDCMOP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide?
The IUPAC name of N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide (CID 115633394) is N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide.
What is the SMILES notation for N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide?
The canonical SMILES for N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide is Cc1[nH]nc(NC(=O)c2ccc(C(F)(F)F)[nH]c2=O)c1C.
What is the InChIKey of N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide?
The InChIKey is MXCPEROVXDCMOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3N4O2/c1-5-6(2)18-19-9(5)17-11(21)7-3-4-8(12(13,14)15)16-10(7)20/h3-4H,1-2H3,(H,16,20)(H2,17,18,19,21).
What are the key properties of N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide?
N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide has a molecular weight of 300.24 g/mol, XLogP of 1.99, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide is sourced from PubChem (CID 115633394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).