About 2-[prop-2-enyl(1,3-thiazol-4-ylmethyl)amino]ethanol
2-[prop-2-enyl(1,3-thiazol-4-ylmethyl)amino]ethanol (PubChem CID 115633439) has the molecular formula C9H14N2OS
and a molecular weight of 198.29 g/mol. Its IUPAC name is 2-[prop-2-enyl(1,3-thiazol-4-ylmethyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[prop-2-enyl(1,3-thiazol-4-ylmethyl)amino]ethanol |
| PubChem CID | 115633439 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-[prop-2-enyl(1,3-thiazol-4-ylmethyl)amino]ethanol |
| SMILES | C=CCN(CCO)Cc1cscn1 |
| InChI | InChI=1S/C9H14N2OS/c1-2-3-11(4-5-12)6-9-7-13-8-10-9/h2,7-8,12H,1,3-6H2 |
| InChIKey | RDWPHMAERFMTFK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[prop-2-enyl(1,3-thiazol-4-ylmethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[prop-2-enyl(1,3-thiazol-4-ylmethyl)amino]ethanol?
The IUPAC name of 2-[prop-2-enyl(1,3-thiazol-4-ylmethyl)amino]ethanol (CID 115633439) is 2-[prop-2-enyl(1,3-thiazol-4-ylmethyl)amino]ethanol.
What is the SMILES notation for 2-[prop-2-enyl(1,3-thiazol-4-ylmethyl)amino]ethanol?
The canonical SMILES for 2-[prop-2-enyl(1,3-thiazol-4-ylmethyl)amino]ethanol is C=CCN(CCO)Cc1cscn1.
What is the InChIKey of 2-[prop-2-enyl(1,3-thiazol-4-ylmethyl)amino]ethanol?
The InChIKey is RDWPHMAERFMTFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2OS/c1-2-3-11(4-5-12)6-9-7-13-8-10-9/h2,7-8,12H,1,3-6H2.
What are the key properties of 2-[prop-2-enyl(1,3-thiazol-4-ylmethyl)amino]ethanol?
2-[prop-2-enyl(1,3-thiazol-4-ylmethyl)amino]ethanol has a molecular weight of 198.29 g/mol, XLogP of 1.12, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[prop-2-enyl(1,3-thiazol-4-ylmethyl)amino]ethanol is sourced from PubChem (CID 115633439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).