C15H17ClN2OS — CID 115633493
2-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl-prop-2-enylamino]ethanol (PubChem CID 115633493) has the molecular formula C15H17ClN2OS and a molecular weight of 308.83 g/mol. Its IUPAC name is 2-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl-prop-2-enylamino]ethanol.
| Compound Name | 2-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl-prop-2-enylamino]ethanol |
|---|---|
| PubChem CID | 115633493 |
| Molecular Formula | C15H17ClN2OS |
| Molecular Weight | 308.83 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl-prop-2-enylamino]ethanol |
| SMILES | C=CCN(CCO)Cc1csc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C15H17ClN2OS/c1-2-7-18(8-9-19)10-12-11-20-15(17-12)13-5-3-4-6-14(13)16/h2-6,11,19H,1,7-10H2 |
| InChIKey | FOQKEXNLVPBSBY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.83 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|