C32H41N3O6S — CID 11563369
2-cycloheptyloxy-N-(3-hydroxypropylsulfonyl)-4-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]benzamide (PubChem CID 11563369) has the molecular formula C32H41N3O6S and a molecular weight of 595.76 g/mol. Its IUPAC name is 2-cycloheptyloxy-N-(3-hydroxypropylsulfonyl)-4-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]benzamide.
| Compound Name | 2-cycloheptyloxy-N-(3-hydroxypropylsulfonyl)-4-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 11563369 |
| Molecular Formula | C32H41N3O6S |
| Molecular Weight | 595.76 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | 2-cycloheptyloxy-N-(3-hydroxypropylsulfonyl)-4-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]benzamide |
| SMILES | O=C(NS(=O)(=O)CCCO)c1ccc(-c2ccc(CCNC[C@H](O)c3cccnc3)cc2)cc1OC1CCCCCC1 |
| InChI | InChI=1S/C32H41N3O6S/c36-19-6-20-42(39,40)35-32(38)29-15-14-26(21-31(29)41-28-8-3-1-2-4-9-28)25-12-10-24(11-13-25)16-18-34-23-30(37)27-7-5-17-33-22-27/h5,7,10-15,17,21-22,28,30,34,36-37H,1-4,6,8-9,16,18-20,23H2,(H,35,38)/t30-/m0/s1 |
| InChIKey | KNMGDJHWPKTAHL-PMERELPUSA-N |
| XLogP | 4.16 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.76 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|