C9H10Br2N2O — CID 115633882
4,5-dibromo-2-pent-4-enylpyridazin-3-one (PubChem CID 115633882) has the molecular formula C9H10Br2N2O and a molecular weight of 322.00 g/mol. Its IUPAC name is 4,5-dibromo-2-pent-4-enylpyridazin-3-one.
| Compound Name | 4,5-dibromo-2-pent-4-enylpyridazin-3-one |
|---|---|
| PubChem CID | 115633882 |
| Molecular Formula | C9H10Br2N2O |
| Molecular Weight | 322.00 g/mol |
| Exact Mass | 319.92 |
| IUPAC Name | 4,5-dibromo-2-pent-4-enylpyridazin-3-one |
| SMILES | C=CCCCn1ncc(Br)c(Br)c1=O |
| InChI | InChI=1S/C9H10Br2N2O/c1-2-3-4-5-13-9(14)8(11)7(10)6-12-13/h2,6H,1,3-5H2 |
| InChIKey | SAJLJFGQXDJPNY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.00 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|