About 4-cyclopentylsulfonyl-3,3-dimethylpiperazin-2-one
4-cyclopentylsulfonyl-3,3-dimethylpiperazin-2-one (PubChem CID 115634074) has the molecular formula C11H20N2O3S
and a molecular weight of 260.36 g/mol. Its IUPAC name is 4-cyclopentylsulfonyl-3,3-dimethylpiperazin-2-one.
Molecular Properties
| Compound Name | 4-cyclopentylsulfonyl-3,3-dimethylpiperazin-2-one |
| PubChem CID | 115634074 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 4-cyclopentylsulfonyl-3,3-dimethylpiperazin-2-one |
| SMILES | CC1(C)C(=O)NCCN1S(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C11H20N2O3S/c1-11(2)10(14)12-7-8-13(11)17(15,16)9-5-3-4-6-9/h9H,3-8H2,1-2H3,(H,12,14) |
| InChIKey | HQCOGGORXFUMCN-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-cyclopentylsulfonyl-3,3-dimethylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopentylsulfonyl-3,3-dimethylpiperazin-2-one?
The IUPAC name of 4-cyclopentylsulfonyl-3,3-dimethylpiperazin-2-one (CID 115634074) is 4-cyclopentylsulfonyl-3,3-dimethylpiperazin-2-one.
What is the SMILES notation for 4-cyclopentylsulfonyl-3,3-dimethylpiperazin-2-one?
The canonical SMILES for 4-cyclopentylsulfonyl-3,3-dimethylpiperazin-2-one is CC1(C)C(=O)NCCN1S(=O)(=O)C1CCCC1.
What is the InChIKey of 4-cyclopentylsulfonyl-3,3-dimethylpiperazin-2-one?
The InChIKey is HQCOGGORXFUMCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O3S/c1-11(2)10(14)12-7-8-13(11)17(15,16)9-5-3-4-6-9/h9H,3-8H2,1-2H3,(H,12,14).
What are the key properties of 4-cyclopentylsulfonyl-3,3-dimethylpiperazin-2-one?
4-cyclopentylsulfonyl-3,3-dimethylpiperazin-2-one has a molecular weight of 260.36 g/mol, XLogP of 0.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopentylsulfonyl-3,3-dimethylpiperazin-2-one is sourced from PubChem (CID 115634074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).