C10H20N2OS — CID 115635226
2,3-dimethyl-N-propylthiomorpholine-4-carboxamide (PubChem CID 115635226) has the molecular formula C10H20N2OS and a molecular weight of 216.35 g/mol. Its IUPAC name is 2,3-dimethyl-N-propylthiomorpholine-4-carboxamide.
| Compound Name | 2,3-dimethyl-N-propylthiomorpholine-4-carboxamide |
|---|---|
| PubChem CID | 115635226 |
| Molecular Formula | C10H20N2OS |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2,3-dimethyl-N-propylthiomorpholine-4-carboxamide |
| SMILES | CCCNC(=O)N1CCSC(C)C1C |
| InChI | InChI=1S/C10H20N2OS/c1-4-5-11-10(13)12-6-7-14-9(3)8(12)2/h8-9H,4-7H2,1-3H3,(H,11,13) |
| InChIKey | VWFPHJDAJCXGAH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |