C12H17ClN2S — CID 115635244
4-[(6-chloro-3-pyridinyl)methyl]-2,3-dimethylthiomorpholine (PubChem CID 115635244) has the molecular formula C12H17ClN2S and a molecular weight of 256.80 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)methyl]-2,3-dimethylthiomorpholine.
| Compound Name | 4-[(6-chloro-3-pyridinyl)methyl]-2,3-dimethylthiomorpholine |
|---|---|
| PubChem CID | 115635244 |
| Molecular Formula | C12H17ClN2S |
| Molecular Weight | 256.80 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)methyl]-2,3-dimethylthiomorpholine |
| SMILES | CC1SCCN(Cc2ccc(Cl)nc2)C1C |
| InChI | InChI=1S/C12H17ClN2S/c1-9-10(2)16-6-5-15(9)8-11-3-4-12(13)14-7-11/h3-4,7,9-10H,5-6,8H2,1-2H3 |
| InChIKey | ZPWQMGUXHIIBKM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.80 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|