C13H16Cl2N2O3S — CID 115636278
3,4-dichloro-N-methyl-N-(4-methylsulfanylbutan-2-yl)-5-nitrobenzamide (PubChem CID 115636278) has the molecular formula C13H16Cl2N2O3S and a molecular weight of 351.26 g/mol. Its IUPAC name is 3,4-dichloro-N-methyl-N-(4-methylsulfanylbutan-2-yl)-5-nitrobenzamide.
| Compound Name | 3,4-dichloro-N-methyl-N-(4-methylsulfanylbutan-2-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 115636278 |
| Molecular Formula | C13H16Cl2N2O3S |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 3,4-dichloro-N-methyl-N-(4-methylsulfanylbutan-2-yl)-5-nitrobenzamide |
| SMILES | CSCCC(C)N(C)C(=O)c1cc(Cl)c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H16Cl2N2O3S/c1-8(4-5-21-3)16(2)13(18)9-6-10(14)12(15)11(7-9)17(19)20/h6-8H,4-5H2,1-3H3 |
| InChIKey | DRLMBBUQALEUDT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|