C9H10ClNOS — CID 115636481
N-(2-chloroprop-2-enyl)-2-thiophen-2-ylacetamide (PubChem CID 115636481) has the molecular formula C9H10ClNOS and a molecular weight of 215.70 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-2-thiophen-2-ylacetamide.
| Compound Name | N-(2-chloroprop-2-enyl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 115636481 |
| Molecular Formula | C9H10ClNOS |
| Molecular Weight | 215.70 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-2-thiophen-2-ylacetamide |
| SMILES | C=C(Cl)CNC(=O)Cc1cccs1 |
| InChI | InChI=1S/C9H10ClNOS/c1-7(10)6-11-9(12)5-8-3-2-4-13-8/h2-4H,1,5-6H2,(H,11,12) |
| InChIKey | ZHINNCMNLKUMSK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.70 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |