C12H13Cl2NO2 — CID 115636700
2-(2-chlorophenoxy)-N-(2-chloroprop-2-enyl)propanamide (PubChem CID 115636700) has the molecular formula C12H13Cl2NO2 and a molecular weight of 274.15 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-(2-chloroprop-2-enyl)propanamide.
| Compound Name | 2-(2-chlorophenoxy)-N-(2-chloroprop-2-enyl)propanamide |
|---|---|
| PubChem CID | 115636700 |
| Molecular Formula | C12H13Cl2NO2 |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-(2-chloroprop-2-enyl)propanamide |
| SMILES | C=C(Cl)CNC(=O)C(C)Oc1ccccc1Cl |
| InChI | InChI=1S/C12H13Cl2NO2/c1-8(13)7-15-12(16)9(2)17-11-6-4-3-5-10(11)14/h3-6,9H,1,7H2,2H3,(H,15,16) |
| InChIKey | GIWVUQZXBQRUJB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |