C34H48N4O9 — CID 11563712
2-[[3-[[(7R,9S,12S)-12-cyclohexyl-5,5-dimethyl-11,14-dioxo-2,6-dioxa-10,13-diazatricyclo[14.3.1.17,10]henicosa-1(19),16(20),17-triene-9-carbonyl]amino]-2-oxohexanoyl]amino]acetic acid (PubChem CID 11563712) has the molecular formula C34H48N4O9 and a molecular weight of 656.78 g/mol. Its IUPAC name is 2-[[3-[[(7R,9S,12S)-12-cyclohexyl-5,5-dimethyl-11,14-dioxo-2,6-dioxa-10,13-diazatricyclo[14.3.1.17,10]henicosa-1(19),16(20),17-triene-9-carbonyl]amino]-2-oxohexanoyl]amino]acetic acid.
| Compound Name | 2-[[3-[[(7R,9S,12S)-12-cyclohexyl-5,5-dimethyl-11,14-dioxo-2,6-dioxa-10,13-diazatricyclo[14.3.1.17,10]henicosa-1(19),16(20),17-triene-9-carbonyl]amino]-2-oxohexanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 11563712 |
| Molecular Formula | C34H48N4O9 |
| Molecular Weight | 656.78 g/mol |
| Exact Mass | 656.34 |
| IUPAC Name | 2-[[3-[[(7R,9S,12S)-12-cyclohexyl-5,5-dimethyl-11,14-dioxo-2,6-dioxa-10,13-diazatricyclo[14.3.1.17,10]henicosa-1(19),16(20),17-triene-9-carbonyl]amino]-2-oxohexanoyl]amino]acetic acid |
| SMILES | CCCC(NC(=O)[C@@H]1C[C@@H]2CN1C(=O)[C@H](C1CCCCC1)NC(=O)Cc1cccc(c1)OCCC(C)(C)O2)C(=O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C34H48N4O9/c1-4-9-25(30(42)32(44)35-19-28(40)41)36-31(43)26-18-24-20-38(26)33(45)29(22-11-6-5-7-12-22)37-27(39)17-21-10-8-13-23(16-21)46-15-14-34(2,3)47-24/h8,10,13,16,22,24-26,29H,4-7,9,11-12,14-15,17-20H2,1-3H3,(H,35,44)(H,36,43)(H,37,39)(H,40,41)/t24-,25?,26+,29+/m1/s1 |
| InChIKey | RHMKKGGJMOZLFP-CLBFAXSBSA-N |
| XLogP | 1.90 |
| TPSA | 180.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.78 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|