C9H12ClN3 — CID 115637255
N-(2-chloroprop-2-enyl)-2,6-dimethylpyrimidin-4-amine (PubChem CID 115637255) has the molecular formula C9H12ClN3 and a molecular weight of 197.67 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-2,6-dimethylpyrimidin-4-amine.
| Compound Name | N-(2-chloroprop-2-enyl)-2,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 115637255 |
| Molecular Formula | C9H12ClN3 |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-2,6-dimethylpyrimidin-4-amine |
| SMILES | C=C(Cl)CNc1cc(C)nc(C)n1 |
| InChI | InChI=1S/C9H12ClN3/c1-6(10)5-11-9-4-7(2)12-8(3)13-9/h4H,1,5H2,2-3H3,(H,11,12,13) |
| InChIKey | YWHCOPQCYKSXJL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |