C8H17N3O3S — CID 115638456
N,2-diethyl-3-oxopiperazine-1-sulfonamide (PubChem CID 115638456) has the molecular formula C8H17N3O3S and a molecular weight of 235.31 g/mol. Its IUPAC name is N,2-diethyl-3-oxopiperazine-1-sulfonamide.
| Compound Name | N,2-diethyl-3-oxopiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 115638456 |
| Molecular Formula | C8H17N3O3S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | N,2-diethyl-3-oxopiperazine-1-sulfonamide |
| SMILES | CCNS(=O)(=O)N1CCNC(=O)C1CC |
| InChI | InChI=1S/C8H17N3O3S/c1-3-7-8(12)9-5-6-11(7)15(13,14)10-4-2/h7,10H,3-6H2,1-2H3,(H,9,12) |
| InChIKey | WIZAAVZLUSLCOC-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |