C9H17ClN2O2S — CID 115638619
N-(2-chloroprop-2-enyl)-4-methylpiperidine-1-sulfonamide (PubChem CID 115638619) has the molecular formula C9H17ClN2O2S and a molecular weight of 252.77 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-4-methylpiperidine-1-sulfonamide.
| Compound Name | N-(2-chloroprop-2-enyl)-4-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 115638619 |
| Molecular Formula | C9H17ClN2O2S |
| Molecular Weight | 252.77 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-4-methylpiperidine-1-sulfonamide |
| SMILES | C=C(Cl)CNS(=O)(=O)N1CCC(C)CC1 |
| InChI | InChI=1S/C9H17ClN2O2S/c1-8-3-5-12(6-4-8)15(13,14)11-7-9(2)10/h8,11H,2-7H2,1H3 |
| InChIKey | YQDZKKZAAWOKIA-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.77 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |