C11H23N — CID 115639400
N-(3-cyclopropylpropyl)-2,2-dimethylpropan-1-amine (PubChem CID 115639400) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is N-(3-cyclopropylpropyl)-2,2-dimethylpropan-1-amine.
| Compound Name | N-(3-cyclopropylpropyl)-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 115639400 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | N-(3-cyclopropylpropyl)-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)CNCCCC1CC1 |
| InChI | InChI=1S/C11H23N/c1-11(2,3)9-12-8-4-5-10-6-7-10/h10,12H,4-9H2,1-3H3 |
| InChIKey | DFCMDHSBCNMRFL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|