C11H15BrFNS — CID 115639897
N-[(5-bromo-2-fluorophenyl)methyl]-1-methylsulfanylpropan-2-amine (PubChem CID 115639897) has the molecular formula C11H15BrFNS and a molecular weight of 292.22 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-1-methylsulfanylpropan-2-amine.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-1-methylsulfanylpropan-2-amine |
|---|---|
| PubChem CID | 115639897 |
| Molecular Formula | C11H15BrFNS |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-1-methylsulfanylpropan-2-amine |
| SMILES | CSCC(C)NCc1cc(Br)ccc1F |
| InChI | InChI=1S/C11H15BrFNS/c1-8(7-15-2)14-6-9-5-10(12)3-4-11(9)13/h3-5,8,14H,6-7H2,1-2H3 |
| InChIKey | GCSLIOWIHGCGSW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |