C13H20BrNOS — CID 115640127
N-[(5-bromo-2-methoxyphenyl)methyl]-4-methylsulfanylbutan-2-amine (PubChem CID 115640127) has the molecular formula C13H20BrNOS and a molecular weight of 318.28 g/mol. Its IUPAC name is N-[(5-bromo-2-methoxyphenyl)methyl]-4-methylsulfanylbutan-2-amine.
| Compound Name | N-[(5-bromo-2-methoxyphenyl)methyl]-4-methylsulfanylbutan-2-amine |
|---|---|
| PubChem CID | 115640127 |
| Molecular Formula | C13H20BrNOS |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | N-[(5-bromo-2-methoxyphenyl)methyl]-4-methylsulfanylbutan-2-amine |
| SMILES | COc1ccc(Br)cc1CNC(C)CCSC |
| InChI | InChI=1S/C13H20BrNOS/c1-10(6-7-17-3)15-9-11-8-12(14)4-5-13(11)16-2/h4-5,8,10,15H,6-7,9H2,1-3H3 |
| InChIKey | FHNAYQJRSDIPII-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |