About bis(bis(oxan-4-yloxy)-sulfanylidene-sulfido-λ5-phosphane);platinum(2+)
bis(bis(oxan-4-yloxy)-sulfanylidene-sulfido-λ5-phosphane);platinum(2+) (PubChem CID 11564047) has the molecular formula C20H36O8P2PtS4
and a molecular weight of 789.79 g/mol. Its IUPAC name is bis(bis(oxan-4-yloxy)-sulfanylidene-sulfido-λ5-phosphane);platinum(2+).
Molecular Properties
| Compound Name | bis(bis(oxan-4-yloxy)-sulfanylidene-sulfido-λ5-phosphane);platinum(2+) |
| PubChem CID | 11564047 |
| Molecular Formula | C20H36O8P2PtS4 |
| Molecular Weight | 789.79 g/mol |
| Exact Mass | 789.04 |
| IUPAC Name | bis(bis(oxan-4-yloxy)-sulfanylidene-sulfido-λ5-phosphane);platinum(2+) |
| SMILES | S=P([S-])(OC1CCOCC1)OC1CCOCC1.S=P([S-])(OC1CCOCC1)OC1CCOCC1.[Pt+2] |
| InChI | InChI=1S/2C10H19O4PS2.Pt/c2*16-15(17,13-9-1-5-11-6-2-9)14-10-3-7-12-8-4-10;/h2*9-10H,1-8H2,(H,16,17);/q;;+2/p-2 |
| InChIKey | BWHQLOBGCDJNMY-UHFFFAOYSA-L |
| XLogP | 4.30 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 789.79 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(bis(oxan-4-yloxy)-sulfanylidene-sulfido-λ5-phosphane);platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(bis(oxan-4-yloxy)-sulfanylidene-sulfido-λ5-phosphane);platinum(2+)?
The IUPAC name of bis(bis(oxan-4-yloxy)-sulfanylidene-sulfido-λ5-phosphane);platinum(2+) (CID 11564047) is bis(bis(oxan-4-yloxy)-sulfanylidene-sulfido-λ5-phosphane);platinum(2+).
What is the SMILES notation for bis(bis(oxan-4-yloxy)-sulfanylidene-sulfido-λ5-phosphane);platinum(2+)?
The canonical SMILES for bis(bis(oxan-4-yloxy)-sulfanylidene-sulfido-λ5-phosphane);platinum(2+) is S=P([S-])(OC1CCOCC1)OC1CCOCC1.S=P([S-])(OC1CCOCC1)OC1CCOCC1.[Pt+2].
What is the InChIKey of bis(bis(oxan-4-yloxy)-sulfanylidene-sulfido-λ5-phosphane);platinum(2+)?
The InChIKey is BWHQLOBGCDJNMY-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H19O4PS2.Pt/c2*16-15(17,13-9-1-5-11-6-2-9)14-10-3-7-12-8-4-10;/h2*9-10H,1-8H2,(H,16,17);/q;;+2/p-2.
What are the key properties of bis(bis(oxan-4-yloxy)-sulfanylidene-sulfido-λ5-phosphane);platinum(2+)?
bis(bis(oxan-4-yloxy)-sulfanylidene-sulfido-λ5-phosphane);platinum(2+) has a molecular weight of 789.79 g/mol, XLogP of 4.30, 8 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for bis(bis(oxan-4-yloxy)-sulfanylidene-sulfido-λ5-phosphane);platinum(2+) is sourced from PubChem (CID 11564047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).