C11H18N2S2 — CID 115640533
N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-prop-2-enylsulfanylethanamine (PubChem CID 115640533) has the molecular formula C11H18N2S2 and a molecular weight of 242.41 g/mol. Its IUPAC name is N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-prop-2-enylsulfanylethanamine.
| Compound Name | N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-prop-2-enylsulfanylethanamine |
|---|---|
| PubChem CID | 115640533 |
| Molecular Formula | C11H18N2S2 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-prop-2-enylsulfanylethanamine |
| SMILES | C=CCSCCNCc1sc(C)nc1C |
| InChI | InChI=1S/C11H18N2S2/c1-4-6-14-7-5-12-8-11-9(2)13-10(3)15-11/h4,12H,1,5-8H2,2-3H3 |
| InChIKey | PYIAHUQIZZQOPA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|