C33H39F17O3 — CID 11564079
(2R,4E,6S,8E,10R,11R)-11-[[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)phenyl]methoxy]-2,6,10-trimethyldodeca-4,8-dien-1-ol (PubChem CID 11564079) has the molecular formula C33H39F17O3 and a molecular weight of 806.64 g/mol. Its IUPAC name is (2R,4E,6S,8E,10R,11R)-11-[[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)phenyl]methoxy]-2,6,10-trimethyldodeca-4,8-dien-1-ol.
| Compound Name | (2R,4E,6S,8E,10R,11R)-11-[[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)phenyl]methoxy]-2,6,10-trimethyldodeca-4,8-dien-1-ol |
|---|---|
| PubChem CID | 11564079 |
| Molecular Formula | C33H39F17O3 |
| Molecular Weight | 806.64 g/mol |
| Exact Mass | 806.26 |
| IUPAC Name | (2R,4E,6S,8E,10R,11R)-11-[[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)phenyl]methoxy]-2,6,10-trimethyldodeca-4,8-dien-1-ol |
| SMILES | C[C@@H](CO)C/C=C/[C@@H](C)C/C=C/[C@@H](C)[C@@H](C)OCc1ccc(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C33H39F17O3/c1-20(8-5-10-21(2)18-51)9-6-11-22(3)23(4)53-19-24-12-14-25(15-13-24)52-17-7-16-26(34,35)27(36,37)28(38,39)29(40,41)30(42,43)31(44,45)32(46,47)33(48,49)50/h5-6,8,11-15,20-23,51H,7,9-10,16-19H2,1-4H3/b8-5+,11-6+/t20-,21-,22-,23-/m1/s1 |
| InChIKey | RCJWLAMPEQKJCZ-HTNPQLFOSA-N |
| XLogP | 11.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.64 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|