About 2-[[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]methyl]phenol
2-[[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]methyl]phenol (PubChem CID 115642851) has the molecular formula C17H27NO2
and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-[[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]methyl]phenol.
Molecular Properties
| Compound Name | 2-[[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]methyl]phenol |
| PubChem CID | 115642851 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 2-[[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]methyl]phenol |
| SMILES | CC(C)COC1CC(NCc2ccccc2O)C1(C)C |
| InChI | InChI=1S/C17H27NO2/c1-12(2)11-20-16-9-15(17(16,3)4)18-10-13-7-5-6-8-14(13)19/h5-8,12,15-16,18-19H,9-11H2,1-4H3 |
| InChIKey | CWENBBGGPIFLBV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]methyl]phenol?
The IUPAC name of 2-[[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]methyl]phenol (CID 115642851) is 2-[[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]methyl]phenol.
What is the SMILES notation for 2-[[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]methyl]phenol?
The canonical SMILES for 2-[[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]methyl]phenol is CC(C)COC1CC(NCc2ccccc2O)C1(C)C.
What is the InChIKey of 2-[[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]methyl]phenol?
The InChIKey is CWENBBGGPIFLBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO2/c1-12(2)11-20-16-9-15(17(16,3)4)18-10-13-7-5-6-8-14(13)19/h5-8,12,15-16,18-19H,9-11H2,1-4H3.
What are the key properties of 2-[[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]methyl]phenol?
2-[[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]methyl]phenol has a molecular weight of 277.41 g/mol, XLogP of 3.32, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]amino]methyl]phenol is sourced from PubChem (CID 115642851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).