C11H19N3O — CID 115644029
3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-methylbutan-1-ol (PubChem CID 115644029) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-methylbutan-1-ol.
| Compound Name | 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 115644029 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-methylbutan-1-ol |
| SMILES | Cc1cc(C)nc(NC(C)C(C)CO)n1 |
| InChI | InChI=1S/C11H19N3O/c1-7(6-15)10(4)14-11-12-8(2)5-9(3)13-11/h5,7,10,15H,6H2,1-4H3,(H,12,13,14) |
| InChIKey | UGGVAJAGRDGXCK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |