About 1-[4-(3-chloropropyl)phenyl]sulfonyl-2,4-dimethylpyrrolidine
1-[4-(3-chloropropyl)phenyl]sulfonyl-2,4-dimethylpyrrolidine (PubChem CID 115644416) has the molecular formula C15H22ClNO2S
and a molecular weight of 315.87 g/mol. Its IUPAC name is 1-[4-(3-chloropropyl)phenyl]sulfonyl-2,4-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 1-[4-(3-chloropropyl)phenyl]sulfonyl-2,4-dimethylpyrrolidine |
| PubChem CID | 115644416 |
| Molecular Formula | C15H22ClNO2S |
| Molecular Weight | 315.87 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 1-[4-(3-chloropropyl)phenyl]sulfonyl-2,4-dimethylpyrrolidine |
| SMILES | CC1CC(C)N(S(=O)(=O)c2ccc(CCCCl)cc2)C1 |
| InChI | InChI=1S/C15H22ClNO2S/c1-12-10-13(2)17(11-12)20(18,19)15-7-5-14(6-8-15)4-3-9-16/h5-8,12-13H,3-4,9-11H2,1-2H3 |
| InChIKey | LINGSEORFCYSGK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.87 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(3-chloropropyl)phenyl]sulfonyl-2,4-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3-chloropropyl)phenyl]sulfonyl-2,4-dimethylpyrrolidine?
The IUPAC name of 1-[4-(3-chloropropyl)phenyl]sulfonyl-2,4-dimethylpyrrolidine (CID 115644416) is 1-[4-(3-chloropropyl)phenyl]sulfonyl-2,4-dimethylpyrrolidine.
What is the SMILES notation for 1-[4-(3-chloropropyl)phenyl]sulfonyl-2,4-dimethylpyrrolidine?
The canonical SMILES for 1-[4-(3-chloropropyl)phenyl]sulfonyl-2,4-dimethylpyrrolidine is CC1CC(C)N(S(=O)(=O)c2ccc(CCCCl)cc2)C1.
What is the InChIKey of 1-[4-(3-chloropropyl)phenyl]sulfonyl-2,4-dimethylpyrrolidine?
The InChIKey is LINGSEORFCYSGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22ClNO2S/c1-12-10-13(2)17(11-12)20(18,19)15-7-5-14(6-8-15)4-3-9-16/h5-8,12-13H,3-4,9-11H2,1-2H3.
What are the key properties of 1-[4-(3-chloropropyl)phenyl]sulfonyl-2,4-dimethylpyrrolidine?
1-[4-(3-chloropropyl)phenyl]sulfonyl-2,4-dimethylpyrrolidine has a molecular weight of 315.87 g/mol, XLogP of 3.28, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3-chloropropyl)phenyl]sulfonyl-2,4-dimethylpyrrolidine is sourced from PubChem (CID 115644416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).