C11H17ClN2OS — CID 115644851
3-[(2-chloro-3-pyridinyl)methylamino]-4-methylsulfanylbutan-1-ol (PubChem CID 115644851) has the molecular formula C11H17ClN2OS and a molecular weight of 260.79 g/mol. Its IUPAC name is 3-[(2-chloro-3-pyridinyl)methylamino]-4-methylsulfanylbutan-1-ol.
| Compound Name | 3-[(2-chloro-3-pyridinyl)methylamino]-4-methylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 115644851 |
| Molecular Formula | C11H17ClN2OS |
| Molecular Weight | 260.79 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3-[(2-chloro-3-pyridinyl)methylamino]-4-methylsulfanylbutan-1-ol |
| SMILES | CSCC(CCO)NCc1cccnc1Cl |
| InChI | InChI=1S/C11H17ClN2OS/c1-16-8-10(4-6-15)14-7-9-3-2-5-13-11(9)12/h2-3,5,10,14-15H,4,6-8H2,1H3 |
| InChIKey | HXKMNJWLZTUHHB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.79 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|