C8H15NO — CID 11564486
(3R,4S)-3-prop-1-en-2-ylpiperidin-4-ol (PubChem CID 11564486) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is (3R,4S)-3-prop-1-en-2-ylpiperidin-4-ol.
| Compound Name | (3R,4S)-3-prop-1-en-2-ylpiperidin-4-ol |
|---|---|
| PubChem CID | 11564486 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (3R,4S)-3-prop-1-en-2-ylpiperidin-4-ol |
| SMILES | C=C(C)[C@@H]1CNCC[C@@H]1O |
| InChI | InChI=1S/C8H15NO/c1-6(2)7-5-9-4-3-8(7)10/h7-10H,1,3-5H2,2H3/t7-,8-/m0/s1 |
| InChIKey | UNPANEGGKULUKV-YUMQZZPRSA-N |
| XLogP | 0.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|