C6H8ClNO — CID 11564492
5-(chloromethyl)-2,4-dimethyl-1,3-oxazole (PubChem CID 11564492) has the molecular formula C6H8ClNO and a molecular weight of 145.59 g/mol. Its IUPAC name is 5-(chloromethyl)-2,4-dimethyl-1,3-oxazole.
| Compound Name | 5-(chloromethyl)-2,4-dimethyl-1,3-oxazole |
|---|---|
| PubChem CID | 11564492 |
| Molecular Formula | C6H8ClNO |
| Molecular Weight | 145.59 g/mol |
| Exact Mass | 145.03 |
| IUPAC Name | 5-(chloromethyl)-2,4-dimethyl-1,3-oxazole |
| SMILES | Cc1nc(C)c(CCl)o1 |
| InChI | InChI=1S/C6H8ClNO/c1-4-6(3-7)9-5(2)8-4/h3H2,1-2H3 |
| InChIKey | JWBITJVPRLIJJV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.59 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|