C10H16O — CID 11564505
(1S,4R)-1,3,3-trimethyl-2-oxabicyclo[2.2.2]oct-5-ene (PubChem CID 11564505) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (1S,4R)-1,3,3-trimethyl-2-oxabicyclo[2.2.2]oct-5-ene.
| Compound Name | (1S,4R)-1,3,3-trimethyl-2-oxabicyclo[2.2.2]oct-5-ene |
|---|---|
| PubChem CID | 11564505 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (1S,4R)-1,3,3-trimethyl-2-oxabicyclo[2.2.2]oct-5-ene |
| SMILES | CC1(C)O[C@]2(C)C=C[C@H]1CC2 |
| InChI | InChI=1S/C10H16O/c1-9(2)8-4-6-10(3,11-9)7-5-8/h4,6,8H,5,7H2,1-3H3/t8-,10+/m0/s1 |
| InChIKey | LOOYOTLEOHYYOV-WCBMZHEXSA-N |
| XLogP | 2.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|