About 3-methylspiro[1,3-oxazolidine-5,2'-bicyclo[2.2.1]heptane]-2-one
3-methylspiro[1,3-oxazolidine-5,2'-bicyclo[2.2.1]heptane]-2-one (PubChem CID 11564569) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is 3-methylspiro[1,3-oxazolidine-5,2'-bicyclo[2.2.1]heptane]-2-one.
Molecular Properties
| Compound Name | 3-methylspiro[1,3-oxazolidine-5,2'-bicyclo[2.2.1]heptane]-2-one |
| PubChem CID | 11564569 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 3-methylspiro[1,3-oxazolidine-5,2'-bicyclo[2.2.1]heptane]-2-one |
| SMILES | CN1CC2(CC3CCC2C3)OC1=O |
| InChI | InChI=1S/C10H15NO2/c1-11-6-10(13-9(11)12)5-7-2-3-8(10)4-7/h7-8H,2-6H2,1H3 |
| InChIKey | POTQTCOQWSPZPB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylspiro[1,3-oxazolidine-5,2'-bicyclo[2.2.1]heptane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylspiro[1,3-oxazolidine-5,2'-bicyclo[2.2.1]heptane]-2-one?
The IUPAC name of 3-methylspiro[1,3-oxazolidine-5,2'-bicyclo[2.2.1]heptane]-2-one (CID 11564569) is 3-methylspiro[1,3-oxazolidine-5,2'-bicyclo[2.2.1]heptane]-2-one.
What is the SMILES notation for 3-methylspiro[1,3-oxazolidine-5,2'-bicyclo[2.2.1]heptane]-2-one?
The canonical SMILES for 3-methylspiro[1,3-oxazolidine-5,2'-bicyclo[2.2.1]heptane]-2-one is CN1CC2(CC3CCC2C3)OC1=O.
What is the InChIKey of 3-methylspiro[1,3-oxazolidine-5,2'-bicyclo[2.2.1]heptane]-2-one?
The InChIKey is POTQTCOQWSPZPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-11-6-10(13-9(11)12)5-7-2-3-8(10)4-7/h7-8H,2-6H2,1H3.
What are the key properties of 3-methylspiro[1,3-oxazolidine-5,2'-bicyclo[2.2.1]heptane]-2-one?
3-methylspiro[1,3-oxazolidine-5,2'-bicyclo[2.2.1]heptane]-2-one has a molecular weight of 181.23 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylspiro[1,3-oxazolidine-5,2'-bicyclo[2.2.1]heptane]-2-one is sourced from PubChem (CID 11564569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).