C10H14N2O2S — CID 115646826
3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazol-2-one (PubChem CID 115646826) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazol-2-one.
| Compound Name | 3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 115646826 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazol-2-one |
| SMILES | O=C(Cn1ccsc1=O)N1CCCCC1 |
| InChI | InChI=1S/C10H14N2O2S/c13-9(11-4-2-1-3-5-11)8-12-6-7-15-10(12)14/h6-7H,1-5,8H2 |
| InChIKey | JMERTUSFAWMOHX-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |