About N,N-dimethyl-2-(2-oxo-1,3-thiazol-3-yl)acetamide
N,N-dimethyl-2-(2-oxo-1,3-thiazol-3-yl)acetamide (PubChem CID 115646827) has the molecular formula C7H10N2O2S
and a molecular weight of 186.24 g/mol. Its IUPAC name is N,N-dimethyl-2-(2-oxo-1,3-thiazol-3-yl)acetamide.
Molecular Properties
| Compound Name | N,N-dimethyl-2-(2-oxo-1,3-thiazol-3-yl)acetamide |
| PubChem CID | 115646827 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | N,N-dimethyl-2-(2-oxo-1,3-thiazol-3-yl)acetamide |
| SMILES | CN(C)C(=O)Cn1ccsc1=O |
| InChI | InChI=1S/C7H10N2O2S/c1-8(2)6(10)5-9-3-4-12-7(9)11/h3-4H,5H2,1-2H3 |
| InChIKey | HPJSEMYCGICTOD-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dimethyl-2-(2-oxo-1,3-thiazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2-(2-oxo-1,3-thiazol-3-yl)acetamide?
The IUPAC name of N,N-dimethyl-2-(2-oxo-1,3-thiazol-3-yl)acetamide (CID 115646827) is N,N-dimethyl-2-(2-oxo-1,3-thiazol-3-yl)acetamide.
What is the SMILES notation for N,N-dimethyl-2-(2-oxo-1,3-thiazol-3-yl)acetamide?
The canonical SMILES for N,N-dimethyl-2-(2-oxo-1,3-thiazol-3-yl)acetamide is CN(C)C(=O)Cn1ccsc1=O.
What is the InChIKey of N,N-dimethyl-2-(2-oxo-1,3-thiazol-3-yl)acetamide?
The InChIKey is HPJSEMYCGICTOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S/c1-8(2)6(10)5-9-3-4-12-7(9)11/h3-4H,5H2,1-2H3.
What are the key properties of N,N-dimethyl-2-(2-oxo-1,3-thiazol-3-yl)acetamide?
N,N-dimethyl-2-(2-oxo-1,3-thiazol-3-yl)acetamide has a molecular weight of 186.24 g/mol, XLogP of -0.00, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2-(2-oxo-1,3-thiazol-3-yl)acetamide is sourced from PubChem (CID 115646827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).