About 3-(2-bromoprop-2-enyl)-1,3-thiazol-2-one
3-(2-bromoprop-2-enyl)-1,3-thiazol-2-one (PubChem CID 115646883) has the molecular formula C6H6BrNOS
and a molecular weight of 220.09 g/mol. Its IUPAC name is 3-(2-bromoprop-2-enyl)-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 3-(2-bromoprop-2-enyl)-1,3-thiazol-2-one |
| PubChem CID | 115646883 |
| Molecular Formula | C6H6BrNOS |
| Molecular Weight | 220.09 g/mol |
| Exact Mass | 218.94 |
| IUPAC Name | 3-(2-bromoprop-2-enyl)-1,3-thiazol-2-one |
| SMILES | C=C(Br)Cn1ccsc1=O |
| InChI | InChI=1S/C6H6BrNOS/c1-5(7)4-8-2-3-10-6(8)9/h2-3H,1,4H2 |
| InChIKey | ADBVSMGVQIIWLW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.09 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-bromoprop-2-enyl)-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromoprop-2-enyl)-1,3-thiazol-2-one?
The IUPAC name of 3-(2-bromoprop-2-enyl)-1,3-thiazol-2-one (CID 115646883) is 3-(2-bromoprop-2-enyl)-1,3-thiazol-2-one.
What is the SMILES notation for 3-(2-bromoprop-2-enyl)-1,3-thiazol-2-one?
The canonical SMILES for 3-(2-bromoprop-2-enyl)-1,3-thiazol-2-one is C=C(Br)Cn1ccsc1=O.
What is the InChIKey of 3-(2-bromoprop-2-enyl)-1,3-thiazol-2-one?
The InChIKey is ADBVSMGVQIIWLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrNOS/c1-5(7)4-8-2-3-10-6(8)9/h2-3H,1,4H2.
What are the key properties of 3-(2-bromoprop-2-enyl)-1,3-thiazol-2-one?
3-(2-bromoprop-2-enyl)-1,3-thiazol-2-one has a molecular weight of 220.09 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromoprop-2-enyl)-1,3-thiazol-2-one is sourced from PubChem (CID 115646883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).