C12H23NO2 — CID 115647055
N-(4,4-dimethylcyclohexyl)-2-methoxypropanamide (PubChem CID 115647055) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is N-(4,4-dimethylcyclohexyl)-2-methoxypropanamide.
| Compound Name | N-(4,4-dimethylcyclohexyl)-2-methoxypropanamide |
|---|---|
| PubChem CID | 115647055 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | N-(4,4-dimethylcyclohexyl)-2-methoxypropanamide |
| SMILES | COC(C)C(=O)NC1CCC(C)(C)CC1 |
| InChI | InChI=1S/C12H23NO2/c1-9(15-4)11(14)13-10-5-7-12(2,3)8-6-10/h9-10H,5-8H2,1-4H3,(H,13,14) |
| InChIKey | WOJWRYJMXIPRCW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |