C12H24N2O2 — CID 115648230
N-butyl-2-[3-(2-hydroxyethyl)pyrrolidin-1-yl]acetamide (PubChem CID 115648230) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N-butyl-2-[3-(2-hydroxyethyl)pyrrolidin-1-yl]acetamide.
| Compound Name | N-butyl-2-[3-(2-hydroxyethyl)pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 115648230 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N-butyl-2-[3-(2-hydroxyethyl)pyrrolidin-1-yl]acetamide |
| SMILES | CCCCNC(=O)CN1CCC(CCO)C1 |
| InChI | InChI=1S/C12H24N2O2/c1-2-3-6-13-12(16)10-14-7-4-11(9-14)5-8-15/h11,15H,2-10H2,1H3,(H,13,16) |
| InChIKey | OORMQXCFLGWRNH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|