C17H27NO — CID 11565162
(1R,2S,5R)-2-[2-(benzylamino)propan-2-yl]-5-methylcyclohexan-1-ol (PubChem CID 11565162) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is (1R,2S,5R)-2-[2-(benzylamino)propan-2-yl]-5-methylcyclohexan-1-ol.
| Compound Name | (1R,2S,5R)-2-[2-(benzylamino)propan-2-yl]-5-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 11565162 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | (1R,2S,5R)-2-[2-(benzylamino)propan-2-yl]-5-methylcyclohexan-1-ol |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)NCc2ccccc2)[C@H](O)C1 |
| InChI | InChI=1S/C17H27NO/c1-13-9-10-15(16(19)11-13)17(2,3)18-12-14-7-5-4-6-8-14/h4-8,13,15-16,18-19H,9-12H2,1-3H3/t13-,15-,16-/m1/s1 |
| InChIKey | XKSSDCSYKIZORR-FVQBIDKESA-N |
| XLogP | 3.35 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |