C16H30OSi — CID 11565216
triethyl-[(2E,4Z,6S)-6-methylnona-2,4,8-trien-4-yl]oxysilane (PubChem CID 11565216) has the molecular formula C16H30OSi and a molecular weight of 266.50 g/mol. Its IUPAC name is triethyl-[(2E,4Z,6S)-6-methylnona-2,4,8-trien-4-yl]oxysilane.
| Compound Name | triethyl-[(2E,4Z,6S)-6-methylnona-2,4,8-trien-4-yl]oxysilane |
|---|---|
| PubChem CID | 11565216 |
| Molecular Formula | C16H30OSi |
| Molecular Weight | 266.50 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | triethyl-[(2E,4Z,6S)-6-methylnona-2,4,8-trien-4-yl]oxysilane |
| SMILES | C=CC[C@H](C)/C=C(/C=C/C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C16H30OSi/c1-7-12-15(6)14-16(13-8-2)17-18(9-3,10-4)11-5/h7-8,13-15H,1,9-12H2,2-6H3/b13-8+,16-14-/t15-/m0/s1 |
| InChIKey | AYESZNHSDNRTCJ-YLCRQNSCSA-N |
| XLogP | 5.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|