C14H19N3O — CID 115652268
5-[(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)methyl]furan-2-carbonitrile (PubChem CID 115652268) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 5-[(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)methyl]furan-2-carbonitrile.
| Compound Name | 5-[(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)methyl]furan-2-carbonitrile |
|---|---|
| PubChem CID | 115652268 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 5-[(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)methyl]furan-2-carbonitrile |
| SMILES | N#Cc1ccc(CNC2CCN3CCCC3C2)o1 |
| InChI | InChI=1S/C14H19N3O/c15-9-13-3-4-14(18-13)10-16-11-5-7-17-6-1-2-12(17)8-11/h3-4,11-12,16H,1-2,5-8,10H2 |
| InChIKey | XWGSUGGUISYYJE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 52.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |