C16H15N3O2 — CID 115652504
5-[[3-(2-oxopyrrolidin-1-yl)anilino]methyl]furan-2-carbonitrile (PubChem CID 115652504) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is 5-[[3-(2-oxopyrrolidin-1-yl)anilino]methyl]furan-2-carbonitrile.
| Compound Name | 5-[[3-(2-oxopyrrolidin-1-yl)anilino]methyl]furan-2-carbonitrile |
|---|---|
| PubChem CID | 115652504 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 5-[[3-(2-oxopyrrolidin-1-yl)anilino]methyl]furan-2-carbonitrile |
| SMILES | N#Cc1ccc(CNc2cccc(N3CCCC3=O)c2)o1 |
| InChI | InChI=1S/C16H15N3O2/c17-10-14-6-7-15(21-14)11-18-12-3-1-4-13(9-12)19-8-2-5-16(19)20/h1,3-4,6-7,9,18H,2,5,8,11H2 |
| InChIKey | IPTDWHKMKIYWQN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 69.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |