C12H22N2O3S — CID 115652579
N-ethyl-N-[3-[(3-methylfuran-2-yl)methylamino]propyl]methanesulfonamide (PubChem CID 115652579) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is N-ethyl-N-[3-[(3-methylfuran-2-yl)methylamino]propyl]methanesulfonamide.
| Compound Name | N-ethyl-N-[3-[(3-methylfuran-2-yl)methylamino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 115652579 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N-ethyl-N-[3-[(3-methylfuran-2-yl)methylamino]propyl]methanesulfonamide |
| SMILES | CCN(CCCNCc1occc1C)S(C)(=O)=O |
| InChI | InChI=1S/C12H22N2O3S/c1-4-14(18(3,15)16)8-5-7-13-10-12-11(2)6-9-17-12/h6,9,13H,4-5,7-8,10H2,1-3H3 |
| InChIKey | RVIMQUPCTYCVCX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|