C13H24N2O — CID 115652692
5-[(3-hydroxycyclohexyl)amino]-4,4-dimethylpentanenitrile (PubChem CID 115652692) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 5-[(3-hydroxycyclohexyl)amino]-4,4-dimethylpentanenitrile.
| Compound Name | 5-[(3-hydroxycyclohexyl)amino]-4,4-dimethylpentanenitrile |
|---|---|
| PubChem CID | 115652692 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 5-[(3-hydroxycyclohexyl)amino]-4,4-dimethylpentanenitrile |
| SMILES | CC(C)(CCC#N)CNC1CCCC(O)C1 |
| InChI | InChI=1S/C13H24N2O/c1-13(2,7-4-8-14)10-15-11-5-3-6-12(16)9-11/h11-12,15-16H,3-7,9-10H2,1-2H3 |
| InChIKey | LOIFFNMNMOEXLW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |