About 5-(2-tert-butylsulfanylethylamino)-4,4-dimethylpentanenitrile
5-(2-tert-butylsulfanylethylamino)-4,4-dimethylpentanenitrile (PubChem CID 115653289) has the molecular formula C13H26N2S
and a molecular weight of 242.43 g/mol. Its IUPAC name is 5-(2-tert-butylsulfanylethylamino)-4,4-dimethylpentanenitrile.
Molecular Properties
| Compound Name | 5-(2-tert-butylsulfanylethylamino)-4,4-dimethylpentanenitrile |
| PubChem CID | 115653289 |
| Molecular Formula | C13H26N2S |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 5-(2-tert-butylsulfanylethylamino)-4,4-dimethylpentanenitrile |
| SMILES | CC(C)(CCC#N)CNCCSC(C)(C)C |
| InChI | InChI=1S/C13H26N2S/c1-12(2,3)16-10-9-15-11-13(4,5)7-6-8-14/h15H,6-7,9-11H2,1-5H3 |
| InChIKey | SEOJMGWUDKBJEP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-tert-butylsulfanylethylamino)-4,4-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-tert-butylsulfanylethylamino)-4,4-dimethylpentanenitrile?
The IUPAC name of 5-(2-tert-butylsulfanylethylamino)-4,4-dimethylpentanenitrile (CID 115653289) is 5-(2-tert-butylsulfanylethylamino)-4,4-dimethylpentanenitrile.
What is the SMILES notation for 5-(2-tert-butylsulfanylethylamino)-4,4-dimethylpentanenitrile?
The canonical SMILES for 5-(2-tert-butylsulfanylethylamino)-4,4-dimethylpentanenitrile is CC(C)(CCC#N)CNCCSC(C)(C)C.
What is the InChIKey of 5-(2-tert-butylsulfanylethylamino)-4,4-dimethylpentanenitrile?
The InChIKey is SEOJMGWUDKBJEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2S/c1-12(2,3)16-10-9-15-11-13(4,5)7-6-8-14/h15H,6-7,9-11H2,1-5H3.
What are the key properties of 5-(2-tert-butylsulfanylethylamino)-4,4-dimethylpentanenitrile?
5-(2-tert-butylsulfanylethylamino)-4,4-dimethylpentanenitrile has a molecular weight of 242.43 g/mol, XLogP of 3.44, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-tert-butylsulfanylethylamino)-4,4-dimethylpentanenitrile is sourced from PubChem (CID 115653289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).