About 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-4-methylpentan-3-ol
1-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-4-methylpentan-3-ol (PubChem CID 115654700) has the molecular formula C12H23N3O
and a molecular weight of 225.34 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-4-methylpentan-3-ol.
Molecular Properties
| Compound Name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-4-methylpentan-3-ol |
| PubChem CID | 115654700 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-4-methylpentan-3-ol |
| SMILES | Cc1n[nH]c(C)c1CNCCC(O)C(C)C |
| InChI | InChI=1S/C12H23N3O/c1-8(2)12(16)5-6-13-7-11-9(3)14-15-10(11)4/h8,12-13,16H,5-7H2,1-4H3,(H,14,15) |
| InChIKey | CNDUYXVGLAFZHQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-4-methylpentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-4-methylpentan-3-ol?
The IUPAC name of 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-4-methylpentan-3-ol (CID 115654700) is 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-4-methylpentan-3-ol.
What is the SMILES notation for 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-4-methylpentan-3-ol?
The canonical SMILES for 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-4-methylpentan-3-ol is Cc1n[nH]c(C)c1CNCCC(O)C(C)C.
What is the InChIKey of 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-4-methylpentan-3-ol?
The InChIKey is CNDUYXVGLAFZHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O/c1-8(2)12(16)5-6-13-7-11-9(3)14-15-10(11)4/h8,12-13,16H,5-7H2,1-4H3,(H,14,15).
What are the key properties of 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-4-methylpentan-3-ol?
1-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-4-methylpentan-3-ol has a molecular weight of 225.34 g/mol, XLogP of 1.52, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-4-methylpentan-3-ol is sourced from PubChem (CID 115654700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).