C17H30N2O2 — CID 115654861
tert-butyl 3-[(hex-5-yn-3-ylamino)methyl]piperidine-1-carboxylate (PubChem CID 115654861) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is tert-butyl 3-[(hex-5-yn-3-ylamino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(hex-5-yn-3-ylamino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 115654861 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | tert-butyl 3-[(hex-5-yn-3-ylamino)methyl]piperidine-1-carboxylate |
| SMILES | C#CCC(CC)NCC1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H30N2O2/c1-6-9-15(7-2)18-12-14-10-8-11-19(13-14)16(20)21-17(3,4)5/h1,14-15,18H,7-13H2,2-5H3 |
| InChIKey | RIUWPOVNVGKEBU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|