C12H9F3O5 — CID 11565511
4,5-dioxo-5-[3-(trifluoromethyl)phenoxy]pentanoic acid (PubChem CID 11565511) has the molecular formula C12H9F3O5 and a molecular weight of 290.19 g/mol. Its IUPAC name is 4,5-dioxo-5-[3-(trifluoromethyl)phenoxy]pentanoic acid.
| Compound Name | 4,5-dioxo-5-[3-(trifluoromethyl)phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 11565511 |
| Molecular Formula | C12H9F3O5 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 4,5-dioxo-5-[3-(trifluoromethyl)phenoxy]pentanoic acid |
| SMILES | O=C(O)CCC(=O)C(=O)Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H9F3O5/c13-12(14,15)7-2-1-3-8(6-7)20-11(19)9(16)4-5-10(17)18/h1-3,6H,4-5H2,(H,17,18) |
| InChIKey | BOZDGUQHVHIPJG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|