C12H18ClNO2 — CID 115655341
[2-[(5-chlorofuran-2-yl)methylamino]-1-methylcyclopentyl]methanol (PubChem CID 115655341) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is [2-[(5-chlorofuran-2-yl)methylamino]-1-methylcyclopentyl]methanol.
| Compound Name | [2-[(5-chlorofuran-2-yl)methylamino]-1-methylcyclopentyl]methanol |
|---|---|
| PubChem CID | 115655341 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | [2-[(5-chlorofuran-2-yl)methylamino]-1-methylcyclopentyl]methanol |
| SMILES | CC1(CO)CCCC1NCc1ccc(Cl)o1 |
| InChI | InChI=1S/C12H18ClNO2/c1-12(8-15)6-2-3-10(12)14-7-9-4-5-11(13)16-9/h4-5,10,14-15H,2-3,6-8H2,1H3 |
| InChIKey | ICONJSGBZQMZKA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |