About 5-[(2-ethoxypropylamino)methyl]-N,N-dimethyl-1,3-thiazol-2-amine
5-[(2-ethoxypropylamino)methyl]-N,N-dimethyl-1,3-thiazol-2-amine (PubChem CID 115655685) has the molecular formula C11H21N3OS
and a molecular weight of 243.38 g/mol. Its IUPAC name is 5-[(2-ethoxypropylamino)methyl]-N,N-dimethyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-[(2-ethoxypropylamino)methyl]-N,N-dimethyl-1,3-thiazol-2-amine |
| PubChem CID | 115655685 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 5-[(2-ethoxypropylamino)methyl]-N,N-dimethyl-1,3-thiazol-2-amine |
| SMILES | CCOC(C)CNCc1cnc(N(C)C)s1 |
| InChI | InChI=1S/C11H21N3OS/c1-5-15-9(2)6-12-7-10-8-13-11(16-10)14(3)4/h8-9,12H,5-7H2,1-4H3 |
| InChIKey | IAFYNYKECVYRFK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2-ethoxypropylamino)methyl]-N,N-dimethyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-ethoxypropylamino)methyl]-N,N-dimethyl-1,3-thiazol-2-amine?
The IUPAC name of 5-[(2-ethoxypropylamino)methyl]-N,N-dimethyl-1,3-thiazol-2-amine (CID 115655685) is 5-[(2-ethoxypropylamino)methyl]-N,N-dimethyl-1,3-thiazol-2-amine.
What is the SMILES notation for 5-[(2-ethoxypropylamino)methyl]-N,N-dimethyl-1,3-thiazol-2-amine?
The canonical SMILES for 5-[(2-ethoxypropylamino)methyl]-N,N-dimethyl-1,3-thiazol-2-amine is CCOC(C)CNCc1cnc(N(C)C)s1.
What is the InChIKey of 5-[(2-ethoxypropylamino)methyl]-N,N-dimethyl-1,3-thiazol-2-amine?
The InChIKey is IAFYNYKECVYRFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3OS/c1-5-15-9(2)6-12-7-10-8-13-11(16-10)14(3)4/h8-9,12H,5-7H2,1-4H3.
What are the key properties of 5-[(2-ethoxypropylamino)methyl]-N,N-dimethyl-1,3-thiazol-2-amine?
5-[(2-ethoxypropylamino)methyl]-N,N-dimethyl-1,3-thiazol-2-amine has a molecular weight of 243.38 g/mol, XLogP of 1.72, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-ethoxypropylamino)methyl]-N,N-dimethyl-1,3-thiazol-2-amine is sourced from PubChem (CID 115655685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).