C17H24ClNO — CID 11565569
(1R,9R,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene;hydrochloride (PubChem CID 11565569) has the molecular formula C17H24ClNO and a molecular weight of 293.84 g/mol. Its IUPAC name is (1R,9R,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene;hydrochloride.
| Compound Name | (1R,9R,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene;hydrochloride |
|---|---|
| PubChem CID | 11565569 |
| Molecular Formula | C17H24ClNO |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | (1R,9R,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene;hydrochloride |
| SMILES | COc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)NCC3.Cl |
| InChI | InChI=1S/C17H23NO.ClH/c1-19-13-6-5-12-10-16-14-4-2-3-7-17(14,8-9-18-16)15(12)11-13;/h5-6,11,14,16,18H,2-4,7-10H2,1H3;1H/t14-,16+,17+;/m0./s1 |
| InChIKey | IBNAJETZECTKHN-DYWKTHLTSA-N |
| XLogP | 3.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |