C12H17ClN2O — CID 115656377
2-[[(2-chloro-3-pyridinyl)methylamino]methyl]cyclopentan-1-ol (PubChem CID 115656377) has the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. Its IUPAC name is 2-[[(2-chloro-3-pyridinyl)methylamino]methyl]cyclopentan-1-ol.
| Compound Name | 2-[[(2-chloro-3-pyridinyl)methylamino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 115656377 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-[[(2-chloro-3-pyridinyl)methylamino]methyl]cyclopentan-1-ol |
| SMILES | OC1CCCC1CNCc1cccnc1Cl |
| InChI | InChI=1S/C12H17ClN2O/c13-12-10(4-2-6-15-12)8-14-7-9-3-1-5-11(9)16/h2,4,6,9,11,14,16H,1,3,5,7-8H2 |
| InChIKey | XOWPXRXQGFKTEY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|