C14H21NO — CID 115656460
2-[(2-cyclopropylethylamino)methyl]-4,5-dimethylphenol (PubChem CID 115656460) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-[(2-cyclopropylethylamino)methyl]-4,5-dimethylphenol.
| Compound Name | 2-[(2-cyclopropylethylamino)methyl]-4,5-dimethylphenol |
|---|---|
| PubChem CID | 115656460 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 2-[(2-cyclopropylethylamino)methyl]-4,5-dimethylphenol |
| SMILES | Cc1cc(O)c(CNCCC2CC2)cc1C |
| InChI | InChI=1S/C14H21NO/c1-10-7-13(14(16)8-11(10)2)9-15-6-5-12-3-4-12/h7-8,12,15-16H,3-6,9H2,1-2H3 |
| InChIKey | UJMBHQRQFBJYLD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|